| Product Name | 4-Amino-2-bromocumene |
| CAS No. | 51605-97-1 |
| Synonyms | 2-Bromo-4-isopropylaniline; 2-bromo-4-(propan-2-yl)aniline |
| InChI | InChI=1/C9H12BrN/c1-6(2)7-3-4-9(11)8(10)5-7/h3-6H,11H2,1-2H3 |
| Molecular Formula | C9H12BrN |
| Molecular Weight | 214.1023 |
| Density | 1.355g/cm3 |
| Boiling point | 271.8°C at 760 mmHg |
| Flash point | 118.2°C |
| Refractive index | 1.577 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
51605-97-1 4-amino-2-bromocumene
service@apichina.com