| Product Name | 4-amino-2-(4-methylphenyl)-6-(methylthio)pyrimidine-5-carbonitrile |
| CAS No. | 287922-40-1 |
| Synonyms | 4-amino-2-(4-methylphenyl)-6-(methylsulfanyl)pyrimidine-5-carbonitrile |
| InChI | InChI=1/C13H12N4S/c1-8-3-5-9(6-4-8)12-16-11(15)10(7-14)13(17-12)18-2/h3-6H,1-2H3,(H2,15,16,17) |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.3262 |
| Density | 1.31g/cm3 |
| Melting point | 213℃ |
| Boiling point | 364.9°C at 760 mmHg |
| Flash point | 174.5°C |
| Refractive index | 1.665 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
287922-40-1 4-amino-2-(4-methylphenyl)-6-(methylthio)pyrimidine-5-carbonitrile
service@apichina.com