| Product Name | 4-amino-2,3,5,6-tetrafluorobenzoic acid |
| CAS No. | 944-43-4 |
| InChI | InChI=1/C7H3F4NO2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H,13,14) |
| Molecular Formula | C7H3F4NO2 |
| Molecular Weight | 209.0978 |
| Density | 1.726g/cm3 |
| Melting point | 185-187℃ |
| Boiling point | 283.6°C at 760 mmHg |
| Flash point | 125.3°C |
| Refractive index | 1.529 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
service@apichina.com