| Product Name | 4-amino-2,3,5,6-tetrafluorobenzamide |
| CAS No. | 1548-74-9 |
| InChI | InChI=1/C7H4F4N2O/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H2,13,14) |
| Molecular Formula | C7H4F4N2O |
| Molecular Weight | 208.1131 |
| Density | 1.635g/cm3 |
| Melting point | 185-186℃ |
| Boiling point | 148.4°C at 760 mmHg |
| Flash point | 43.5°C |
| Refractive index | 1.531 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1548-74-9 4-amino-2,3,5,6-tetrafluorobenzamide
service@apichina.com