| Product Name | 4-Amino-1-naphthalenecarbonitrile |
| CAS No. | 58728-64-6 |
| InChI | InChI=1/C11H8N2/c12-7-8-5-6-11(13)10-4-2-1-3-9(8)10/h1-6H,13H2 |
| Molecular Formula | C11H8N2 |
| Molecular Weight | 168.1946 |
| Density | 1.22g/cm3 |
| Melting point | 174.5-176.5℃ |
| Boiling point | 392.4°C at 760 mmHg |
| Flash point | 191.1°C |
| Refractive index | 1.687 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
58728-64-6 4-amino-1-naphthalenecarbonitrile
service@apichina.com