| Product Name | 4-acetylphenoxyacetic acid |
| CAS No. | 1878-81-5 |
| Synonyms | (p-Acetylphenoxy)acetic acid; AI3-15464; Acetic acid, (4-acetylphenoxy)-; (4-acetylphenoxy)acetate |
| InChI | InChI=1/C10H10O4/c1-7(11)8-2-4-9(5-3-8)14-6-10(12)13/h2-5H,6H2,1H3,(H,12,13)/p-1 |
| Molecular Formula | C10H9O4 |
| Molecular Weight | 193.1766 |
| Melting point | 175-177℃ |
| Boiling point | 380.5°C at 760 mmHg |
| Flash point | 154.2°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1878-81-5 4-acetylphenoxyacetic acid
service@apichina.com