| Product Name | 4-acetyl-3-hydroxyphenyl acetate |
| CAS No. | 42059-48-3 |
| InChI | InChI=1/C10H10O4/c1-6(11)9-4-3-8(5-10(9)13)14-7(2)12/h3-5,13H,1-2H3 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.184 |
| Density | 1.236g/cm3 |
| Melting point | 57℃ |
| Boiling point | 331.2°C at 760 mmHg |
| Flash point | 131.4°C |
| Refractive index | 1.543 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
42059-48-3 4-acetyl-3-hydroxyphenyl acetate
service@apichina.com