| Product Name | 4-Acetoxybenzaldehyde |
| CAS No. | 878-00-2 |
| Synonyms | 4-Formylphenyl acetate |
| InChI | InChI=1/C9H8O3/c1-7(11)12-9-4-2-8(6-10)3-5-9/h2-6H,1H3 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.158 |
| Density | 1.183g/cm3 |
| Boiling point | 275°C at 760 mmHg |
| Flash point | 119.4°C |
| Refractive index | 1.552 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
878-00-2 4-acetoxybenzaldehyde
service@apichina.com