| Product Name | 4-Acetamidobenzoyl chloride |
| CAS No. | 16331-48-9 |
| Synonyms | 4-(acetylamino)benzoyl chloride |
| InChI | InChI=1/C9H8ClNO2/c1-6(12)11-8-4-2-7(3-5-8)9(10)13/h2-5H,1H3,(H,11,12) |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.6183 |
| Density | 1.326g/cm3 |
| Boiling point | 387.3°C at 760 mmHg |
| Flash point | 188°C |
| Refractive index | 1.597 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
16331-48-9 4-acetamidobenzoyl chloride
service@apichina.com