| Product Name | 4,7-Dichloroisatin |
| CAS No. | 18711-13-2 |
| Synonyms | 4,7-dichloro-1H-indole-2,3-dione; 4,7-Dichloroindoline-2,3-dione |
| InChI | InChI=1/C8H3Cl2NO2/c9-3-1-2-4(10)6-5(3)7(12)8(13)11-6/h1-2H,(H,11,12,13) |
| Molecular Formula | C8H3Cl2NO2 |
| Molecular Weight | 216.0209 |
| Density | 1.643g/cm3 |
| Melting point | 251-254℃ |
| Refractive index | 1.637 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
18711-13-2 4,7-dichloroisatin
service@apichina.com