| Product Name | 4,6-dichloro-3-phenylpyridazine |
| CAS No. | 40020-05-1 |
| InChI | InChI=1/C10H6Cl2N2/c11-8-6-9(12)13-14-10(8)7-4-2-1-3-5-7/h1-6H |
| Molecular Formula | C10H6Cl2N2 |
| Molecular Weight | 225.074 |
| Density | 1.363g/cm3 |
| Melting point | 83℃ |
| Boiling point | 381.4°C at 760 mmHg |
| Flash point | 216.4°C |
| Refractive index | 1.604 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
40020-05-1 4,6-dichloro-3-phenylpyridazine
service@apichina.com