| Product Name | 4,6-Dichloro-2-methylthio-5-phenylpyrimidine |
| CAS No. | 64415-11-8 |
| Synonyms | 4,6-dichloro-2-(methylsulfanyl)-5-phenylpyrimidine |
| InChI | InChI=1/C11H8Cl2N2S/c1-16-11-14-9(12)8(10(13)15-11)7-5-3-2-4-6-7/h2-6H,1H3 |
| Molecular Formula | C11H8Cl2N2S |
| Molecular Weight | 271.1656 |
| Density | 1.43g/cm3 |
| Melting point | 107-111℃ |
| Boiling point | 364.3°C at 760 mmHg |
| Flash point | 174.1°C |
| Refractive index | 1.657 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
64415-11-8 4,6-dichloro-2-methylthio-5-phenylpyrimidine
service@apichina.com