| Product Name | 4,5-Dinitro-o-phenylenediamine |
| CAS No. | 32690-28-1 |
| Synonyms | 4,5-Dinitro-1,2-diaminobenzene; 4,5-dinitrobenzene-1,2-diamine |
| InChI | InChI=1/C6H6N4O4/c7-3-1-5(9(11)12)6(10(13)14)2-4(3)8/h1-2H,7-8H2 |
| Molecular Formula | C6H6N4O4 |
| Molecular Weight | 198.1362 |
| Density | 1.683g/cm3 |
| Melting point | 213℃ |
| Boiling point | 541.1°C at 760 mmHg |
| Flash point | 281°C |
| Refractive index | 1.747 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
32690-28-1 4,5-dinitro-o-phenylenediamine
service@apichina.com