| Product Name | 4,5-dimethyl-2-nitrophenyl isocyanate |
| CAS No. | 102561-40-0 |
| Synonyms | 1-isocyanato-4,5-dimethyl-2-nitrobenzene |
| InChI | InChI=1/C9H8N2O3/c1-6-3-8(10-5-12)9(11(13)14)4-7(6)2/h3-4H,1-2H3 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.1714 |
| Density | 1.24g/cm3 |
| Melting point | 85-89℃ |
| Boiling point | 321.6°C at 760 mmHg |
| Flash point | 148.3°C |
| Refractive index | 1.569 |
| Risk Codes | R23/25:Toxic by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
102561-40-0 4,5-dimethyl-2-nitrophenyl isocyanate
service@apichina.com