| Product Name | 4,5-Dimethyl-2-nitroaniline |
| CAS No. | 6972-71-0 |
| Synonyms | 2-Nitro-4,5-Dimethyl Aniline; 6-Nitro-3,4-xylidine |
| InChI | InChI=1/C8H10N2O2/c1-5-3-7(9)8(10(11)12)4-6(5)2/h3-4H,9H2,1-2H3 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.1772 |
| Density | 1.22g/cm3 |
| Melting point | 138-143℃ |
| Boiling point | 335.7°C at 760 mmHg |
| Flash point | 156.8°C |
| Refractive index | 1.601 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
6972-71-0 4,5-dimethyl-2-nitroaniline
service@apichina.com