| Product Name | 4,5-Dimethoxy-2-nitrophenylacetic acid |
| CAS No. | 73357-18-3 |
| Synonyms | 2-(4,5-Dimethoxy-2-nitrophenyl)acetic acid; (4,5-dimethoxy-2-nitrophenyl)acetate |
| InChI | InChI=1/C10H11NO6/c1-16-8-3-6(4-10(12)13)7(11(14)15)5-9(8)17-2/h3,5H,4H2,1-2H3,(H,12,13)/p-1 |
| Molecular Formula | C10H10NO6 |
| Molecular Weight | 240.19 |
| Melting point | 206-208℃ |
| Boiling point | 433.4°C at 760 mmHg |
| Flash point | 215.9°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
73357-18-3 4,5-dimethoxy-2-nitrophenylacetic acid
service@apichina.com