| Product Name | 4,5-Dimethoxy-1,2-phenylenediamine dihydrochloride |
| CAS No. | 131076-14-7 |
| Synonyms | 1,2-Diamino-4,5-dimethoxybenzene, dihydrochloride (DDB); 4,5-dimethoxybenzene-1,2-diamine dihydrochloride |
| InChI | InChI=1/C8H12N2O2.2ClH/c1-11-7-3-5(9)6(10)4-8(7)12-2;;/h3-4H,9-10H2,1-2H3;2*1H |
| Molecular Formula | C8H14Cl2N2O2 |
| Molecular Weight | 241.115 |
| Boiling point | 385.7°C at 760 mmHg |
| Flash point | 187.1°C |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
131076-14-7 4,5-dimethoxy-1,2-phenylenediamine dihydrochloride
service@apichina.com