| Product Name | 4,5-diiodo-2-methyl-1H-imidazole |
| CAS No. | 73746-44-8 |
| Synonyms | 4,5-Diiodo-2-methylimidazole |
| InChI | InChI=1/C4H4I2N2/c1-2-7-3(5)4(6)8-2/h1H3,(H,7,8) |
| Molecular Formula | C4H4I2N2 |
| Molecular Weight | 333.8969 |
| Density | 2.75g/cm3 |
| Melting point | 194℃ |
| Boiling point | 434.9°C at 760 mmHg |
| Flash point | 216.8°C |
| Refractive index | 1.749 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
73746-44-8 4,5-diiodo-2-methyl-1h-imidazole
service@apichina.com