| Product Name | 4,5-dichloro-6-methyl-2-(2-pyridyl)pyrimidine |
| CAS No. | 306935-55-7 |
| Synonyms | 4,5-dichloro-6-methyl-2-pyridin-2-ylpyrimidine |
| InChI | InChI=1/C10H7Cl2N3/c1-6-8(11)9(12)15-10(14-6)7-4-2-3-5-13-7/h2-5H,1H3 |
| Molecular Formula | C10H7Cl2N3 |
| Molecular Weight | 240.0887 |
| Density | 1.375g/cm3 |
| Melting point | 132℃ |
| Boiling point | 270.4°C at 760 mmHg |
| Flash point | 143.4°C |
| Refractive index | 1.6 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306935-55-7 4,5-dichloro-6-methyl-2-(2-pyridyl)pyrimidine
service@apichina.com