| Product Name | 4,5-Dichloro-2-methylpyridazin-3-one |
| CAS No. | 933-76-6 |
| Synonyms | 3(2H)-Pyridazinone, 4,5-dichloro-2-methyl-; 4,5-Dichloro-2-methyl-3(2H)-pyridazinone; 5-24-02-00023 (Beilstein Handbook Reference); BRN 0127609; 4,5-dichloro-2-methylpyridazin-3(2H)-one |
| InChI | InChI=1/C5H4Cl2N2O/c1-9-5(10)4(7)3(6)2-8-9/h2H,1H3 |
| Molecular Formula | C5H4Cl2N2O |
| Molecular Weight | 179.0041 |
| Density | 1.55g/cm3 |
| Boiling point | 197.2°C at 760 mmHg |
| Flash point | 73.1°C |
| Refractive index | 1.611 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
933-76-6 4,5-dichloro-2-methylpyridazin-3-one
service@apichina.com