| Product Name | 4,5-Dichloro-2-methylimidazole |
| CAS No. | 15965-33-0 |
| Synonyms | 4,5-Dichloro-2-methylmidazole; 4,5-dichloro-2-methyl-1H-imidazole |
| InChI | InChI=1/C4H4Cl2N2/c1-2-7-3(5)4(6)8-2/h1H3,(H,7,8) |
| Molecular Formula | C4H4Cl2N2 |
| Molecular Weight | 150.994 |
| Density | 1.492g/cm3 |
| Melting point | 245-249℃ |
| Boiling point | 345.3°C at 760 mmHg |
| Flash point | 193.4°C |
| Refractive index | 1.574 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
15965-33-0 4,5-dichloro-2-methylimidazole
service@apichina.com