| Product Name | 4,5-dichloro-2-(hydroxymethyl)-2,3-dihydropyridazin-3-one |
| CAS No. | 51355-97-6 |
| Synonyms | 4,5-dichloro-2-(hydroxymethyl)pyridazin-3(2H)-one |
| InChI | InChI=1/C5H4Cl2N2O2/c6-3-1-8-9(2-10)5(11)4(3)7/h1,10H,2H2 |
| Molecular Formula | C5H4Cl2N2O2 |
| Molecular Weight | 195.0035 |
| Density | 1.72g/cm3 |
| Melting point | 97℃ |
| Boiling point | 261.9°C at 760 mmHg |
| Flash point | 112.2°C |
| Refractive index | 1.643 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
51355-97-6 4,5-dichloro-2-(hydroxymethyl)-2,3-dihydropyridazin-3-one
service@apichina.com