| Product Name | 4,5-dichloro-2-(2,6-dichlorobenzyl)-2,3-dihydropyridazin-3-one |
| CAS No. | 175135-43-0 |
| Synonyms | 4,5-dichloro-2-(2,6-dichlorobenzyl)pyridazin-3(2H)-one |
| InChI | InChI=1/C11H6Cl4N2O/c12-7-2-1-3-8(13)6(7)5-17-11(18)10(15)9(14)4-16-17/h1-4H,5H2 |
| Molecular Formula | C11H6Cl4N2O |
| Molecular Weight | 323.9901 |
| Density | 1.59g/cm3 |
| Melting point | 158℃ |
| Boiling point | 393.8°C at 760 mmHg |
| Flash point | 192°C |
| Refractive index | 1.655 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175135-43-0 4,5-dichloro-2-(2,6-dichlorobenzyl)-2,3-dihydropyridazin-3-one
service@apichina.com