| Product Name | 4,5-Dibromothiophene-2-carboxylic acid |
| CAS No. | 6324-10-3 |
| Synonyms | 4,5-Dibromothenoic acid |
| InChI | InChI=1/C5H2Br2O2S/c6-2-1-3(5(8)9)10-4(2)7/h1H,(H,8,9) |
| Molecular Formula | C5H2Br2O2S |
| Molecular Weight | 285.9412 |
| Density | 2.309g/cm3 |
| Boiling point | 367.1°C at 760 mmHg |
| Flash point | 175.8°C |
| Refractive index | 1.682 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6324-10-3 4,5-dibromothiophene-2-carboxylic acid
service@apichina.com