| Product Name | 4,5-Dibromo-o-xylene |
| CAS No. | 24932-48-7 |
| Synonyms | 1,2-Dibromo-4,5-dimethylbenzene |
| InChI | InChI=1/C8H8Br2/c1-5-3-7(9)8(10)4-6(5)2/h3-4H,1-2H3 |
| Molecular Formula | C8H8Br2 |
| Molecular Weight | 263.9571 |
| Density | 1.71g/cm3 |
| Boiling point | 279.1°C at 760 mmHg |
| Flash point | 138.7°C |
| Refractive index | 1.578 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
24932-48-7 4,5-dibromo-o-xylene
service@apichina.com