| Product Name | 4,5-dibromo-2-phenyl-2,3-dihydropyridazin-3-one |
| CAS No. | 14305-08-9 |
| Synonyms | 3(2H)-Pyridazinone, 4,5-dibromo-2-phenyl-; 4,5-Dibromo-2-phenyl-3(2H)-pyridazinone; 4-24-00-00169 (Beilstein Handbook Reference); BRN 0177515; 4,5-dibromo-2-phenylpyridazin-3(2H)-one |
| InChI | InChI=1/C10H6Br2N2O/c11-8-6-13-14(10(15)9(8)12)7-4-2-1-3-5-7/h1-6H |
| Molecular Formula | C10H6Br2N2O |
| Molecular Weight | 329.9754 |
| Density | 1.89g/cm3 |
| Melting point | 143℃ |
| Boiling point | 340.1°C at 760 mmHg |
| Flash point | 159.5°C |
| Refractive index | 1.687 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
14305-08-9 4,5-dibromo-2-phenyl-2,3-dihydropyridazin-3-one
service@apichina.com