| Product Name | 4-(5-bromo-2-thienyl)-2-methyl-1,3-thiazole |
| CAS No. | 352018-87-2 |
| Synonyms | 4-(5-bromothiophen-2-yl)-2-methyl-1,3-thiazole |
| InChI | InChI=1/C8H6BrNS2/c1-5-10-6(4-11-5)7-2-3-8(9)12-7/h2-4H,1H3 |
| Molecular Formula | C8H6BrNS2 |
| Molecular Weight | 260.1739 |
| Density | 1.632g/cm3 |
| Melting point | 78℃ |
| Boiling point | 325°C at 760 mmHg |
| Flash point | 150.4°C |
| Refractive index | 1.651 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
352018-87-2 4-(5-bromo-2-thienyl)-2-methyl-1,3-thiazole
service@apichina.com