| Product Name | 4,5,6-triethoxy-7-nitrophthalide |
| CAS No. | 4995-54-4 |
| Synonyms | 4,5,6-triethoxy-7-nitro-2-benzofuran-1(3H)-one; 4,5,6-triethoxy-7-nitro-1(3H)-Isobenzofuranone |
| InChI | InChI=1/C14H17NO7/c1-4-19-11-8-7-22-14(16)9(8)10(15(17)18)12(20-5-2)13(11)21-6-3/h4-7H2,1-3H3 |
| Molecular Formula | C14H17NO7 |
| Molecular Weight | 311.2873 |
| Density | 1.3g/cm3 |
| Boiling point | 532.3°C at 760 mmHg |
| Flash point | 239.4°C |
| Refractive index | 1.547 |
4995-54-4 4,5,6-triethoxy-7-nitrophthalide
service@apichina.com