| Product Name | 4,5,6,7-tetrahydroindazole |
| CAS No. | 2305-79-5 |
| Synonyms | 4,5,6,7-Tetrahydro-1H-indazole |
| InChI | InChI=1/C7H10N2/c1-2-4-7-6(3-1)5-8-9-7/h5H,1-4H2,(H,8,9) |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.1677 |
| Density | 1.133g/cm3 |
| Melting point | 83-85℃ |
| Boiling point | 291.5°C at 760 mmHg |
| Flash point | 139.2°C |
| Refractive index | 1.573 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2305-79-5 4,5,6,7-tetrahydroindazole
service@apichina.com