| Sales Email | Service@apichina.com |
| CAS No. | 6435-75-2 |
| Product Name | 4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylic acid |
| Synonyms | ethyl (2-chloro-6-ethoxy-4-formylphenoxy)acetate |
| InChI | InChI=1/C13H15ClO5/c1-3-17-11-6-9(7-15)5-10(14)13(11)19-8-12(16)18-4-2/h5-7H,3-4,8H2,1-2H3 |
| Molecular Formula | C13H15ClO5 |
| Molecular Weight | 286.7082 |
| Density | 1.243g/cm3 |
| Melting point | 198℃ |
| Boiling point | 394.5°C at 760 mmHg |
| Flash point | 155.5°C |
| Refractive index | 1.533 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
