| Product Name | 4,5,6,7-tetrachloroindane-1,3-dione |
| CAS No. | 30675-13-9 |
| Synonyms | 1H-indene-1,3(2H)-dione; 4,5,6,7-tetrachloro-1H-indene-1,3(2H)-dione |
| InChI | InChI=1/C9H2Cl4O2/c10-6-4-2(14)1-3(15)5(4)7(11)9(13)8(6)12/h1H2 |
| Molecular Formula | C9H2Cl4O2 |
| Molecular Weight | 283.923 |
| Density | 1.782g/cm3 |
| Melting point | 220℃ |
| Boiling point | 448.1°C at 760 mmHg |
| Flash point | 188.8°C |
| Refractive index | 1.652 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
30675-13-9 4,5,6,7-tetrachloroindane-1,3-dione
service@apichina.com