| Product Name | 4-(4-pyridylmethyl)aniline |
| CAS No. | 27692-74-6 |
| Synonyms | 4-(pyridin-4-ylmethyl)aniline |
| InChI | InChI=1/C12H12N2/c13-12-3-1-10(2-4-12)9-11-5-7-14-8-6-11/h1-8H,9,13H2 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.2371 |
| Density | 1.121g/cm3 |
| Boiling point | 354°C at 760 mmHg |
| Flash point | 195.1°C |
| Refractive index | 1.622 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
27692-74-6 4-(4-pyridylmethyl)aniline
service@apichina.com