| Product Name | 4-[4-(oxiran-2-ylmethoxy)phenyl]-1,2,3-thiadiazole |
| CAS No. | 59834-07-0 |
| InChI | InChI=1/C11H10N2O2S/c1-3-9(14-5-10-6-15-10)4-2-8(1)11-7-16-13-12-11/h1-4,7,10H,5-6H2 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.2743 |
| Density | 1.339g/cm3 |
| Melting point | 70℃ |
| Boiling point | 405.6°C at 760 mmHg |
| Flash point | 199.1°C |
| Refractive index | 1.613 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
59834-07-0 4-[4-(oxiran-2-ylmethoxy)phenyl]-1,2,3-thiadiazole
service@apichina.com