| Product Name | 4-(4-octylphenyl)-4-oxobutanoic acid |
| CAS No. | 64779-10-8 |
| InChI | InChI=1/C18H26O3/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)17(19)13-14-18(20)21/h9-12H,2-8,13-14H2,1H3,(H,20,21) |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.3972 |
| Density | 1.035g/cm3 |
| Melting point | 91℃ |
| Boiling point | 463.4°C at 760 mmHg |
| Flash point | 248.2°C |
| Refractive index | 1.514 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
64779-10-8 4-(4-octylphenyl)-4-oxobutanoic acid
service@apichina.com