| Product Name | 4-(4-nitrophenyl)morpholine |
| CAS No. | 10389-51-2 |
| Synonyms | Morpholine, 4-(4-nitrophenyl)-; 4-(4-Nitrophenyl)morpholine; 4-(p-Nitrophenyl)morpholine; 4-27-00-00037 (Beilstein Handbook Reference); 4-Morpholinyl nitrobenzene; BRN 0210854; Morpholine, 4-(p-nitrophenyl)-; N-(p-Nitrophenyl)-morpholine; NSC 27271; p-Morpholinonitrobenzene |
| InChI | InChI=1/C10H12N2O3/c13-12(14)10-3-1-9(2-4-10)11-5-7-15-8-6-11/h1-4H,5-8H2 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.2139 |
| Density | 1.265g/cm3 |
| Melting point | 150℃ |
| Boiling point | 386.2°C at 760 mmHg |
| Flash point | 187.4°C |
| Refractive index | 1.577 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
10389-51-2 4-(4-nitrophenyl)morpholine
service@apichina.com