| Product Name | 4-(4-Methylpiperazino)acetophenone |
| CAS No. | 26586-55-0 |
| Synonyms | Acetophenone, 4'-(4-methyl-1-piperazinyl)-; 5-23-02-00200 (Beilstein Handbook Reference); BRN 0885205; NSC 102840; p-(4-Methylpiperazino)-acetophenone; 1-(4-(4-Methylpiperazin-1-yl)phenyl)ethan-1-one; Ethanone, 1-(4-(4-methyl-1-piperazinyl)phenyl)- (9CI); 1-[4-(4-methylpiperazin-1-yl)phenyl]ethanone; 4-(4-acetylphenyl)-1-methylpiperazin-1-ium |
| InChI | InChI=1/C13H18N2O/c1-11(16)12-3-5-13(6-4-12)15-9-7-14(2)8-10-15/h3-6H,7-10H2,1-2H3/p+1 |
| Molecular Formula | C13H19N2O |
| Molecular Weight | 219.3022 |
| Melting point | 96-100℃ |
| Boiling point | 365.1°C at 760 mmHg |
| Flash point | 159.1°C |
| Safety | S24/25:Avoid contact with skin and eyes.; |
26586-55-0 4-(4-methylpiperazino)acetophenone
service@apichina.com