| Product Name | 4-(4-methoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
| CAS No. | 213462-19-2 |
| InChI | InChI=1/C14H15NOS/c1-16-11-4-2-10(3-5-11)14-12-7-9-17-13(12)6-8-15-14/h2-5,7,9,14-15H,6,8H2,1H3 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.34 |
| Density | 1.168g/cm3 |
| Melting point | 67℃ |
| Boiling point | 383.4°C at 760 mmHg |
| Flash point | 185.7°C |
| Refractive index | 1.594 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
213462-19-2 4-(4-methoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine
service@apichina.com