| Product Name | 4-(4-methoxyphenyl)-1,2,3-thiadiazol-5-amine |
| CAS No. | 115842-95-0 |
| InChI | InChI=1/C9H9N3OS/c1-13-7-4-2-6(3-5-7)8-9(10)14-12-11-8/h2-5H,10H2,1H3 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.2523 |
| Density | 1.32g/cm3 |
| Melting point | 129.7℃ |
| Boiling point | 376.4°C at 760 mmHg |
| Flash point | 181.4°C |
| Refractive index | 1.636 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
115842-95-0 4-(4-methoxyphenyl)-1,2,3-thiadiazol-5-amine
service@apichina.com