| Product Name | 4-(4-hydroxy-3-methoxyphenyl)butan-2-one oxime |
| CAS No. | 170467-02-4 |
| Synonyms | 4-[3-(hydroxyimino)butyl]-2-methoxyphenol |
| InChI | InChI=1/C11H15NO3/c1-8(12-14)3-4-9-5-6-10(13)11(7-9)15-2/h5-7,13-14H,3-4H2,1-2H3 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.2417 |
| Density | 1.12g/cm3 |
| Melting point | 82℃ |
| Boiling point | 399.3°C at 760 mmHg |
| Flash point | 195.3°C |
| Refractive index | 1.521 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
170467-02-4 4-(4-hydroxy-3-methoxyphenyl)butan-2-one oxime
service@apichina.com