| Product Name | 4-(4-Fluorophenyl)-3-thiosemicarbazide |
| CAS No. | 330-94-9 |
| Synonyms | N-(4-fluorophenyl)hydrazinecarbothioamide |
| InChI | InChI=1/C7H8FN3S/c8-5-1-3-6(4-2-5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
| Molecular Formula | C7H8FN3S |
| Molecular Weight | 185.2219 |
| Density | 1.418g/cm3 |
| Boiling point | 285°C at 760 mmHg |
| Flash point | 126.2°C |
| Refractive index | 1.696 |
| Risk Codes | R25:Toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
330-94-9 4-(4-fluorophenyl)-3-thiosemicarbazide
service@apichina.com