| Product Name | 4-(4-Ethylphenyl)-3-thiosemicarbazide |
| CAS No. | 93693-01-7 |
| Synonyms | N-(4-ethylphenyl)hydrazinecarbothioamide |
| InChI | InChI=1/C9H13N3S/c1-2-7-3-5-8(6-4-7)11-9(13)12-10/h3-6H,2,10H2,1H3,(H2,11,12,13) |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.2846 |
| Density | 1.226g/cm3 |
| Boiling point | 314.5°C at 760 mmHg |
| Flash point | 144°C |
| Refractive index | 1.675 |
| Risk Codes | R25:Toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
93693-01-7 4-(4-ethylphenyl)-3-thiosemicarbazide
service@apichina.com