| Product Name | 4-(4-dipentadecylaminostyryl)-1-methyl-pyridinium iodide |
| CAS No. | 135288-72-1 |
| Synonyms | 4-(4-Dipentadecylaminostyryl)-N-methylpyridinium iodide; 4-{(E)-2-[4-(dipentadecylamino)phenyl]ethenyl}-1-methylpyridinium iodide |
| InChI | InChI=1/C44H75N2.HI/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-38-46(39-29-27-25-23-21-19-17-15-13-11-9-7-5-2)44-34-32-42(33-35-44)30-31-43-36-40-45(3)41-37-43;/h30-37,40-41H,4-29,38-39H2,1-3H3;1H/q+1;/p-1 |
| Molecular Formula | C44H75IN2 |
| Molecular Weight | 758.9842 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
135288-72-1 4-(4-dipentadecylaminostyryl)-1-methyl-pyridinium iodide
service@apichina.com