| Product Name | 4-(4-Chlorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride |
| CAS No. | 51304-61-1 |
| Synonyms | 4-(4-Chlorophenyl)-1,2,3,6-tetrahydro-pyridine HCl; 4-(4-Chloro Phenyl)1,2,3-Tetra Hydropyridine HCL; 4-(4-chlorophenyl)-1,2,3,6-tetrahydropyridinium |
| InChI | InChI=1/C11H12ClN/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-5,13H,6-8H2/p+1 |
| Molecular Formula | C11H13ClN |
| Molecular Weight | 194.6801 |
| Melting point | 199-204℃ |
| Boiling point | 296.5°C at 760 mmHg |
| Flash point | 133.1°C |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R40:Possible risks of irreversible effects.; |
| Safety | S28A:After contact with skin, wash immediately with plenty of water.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S38:In case of insufficient ventilation, wear suitable respiratory equipment.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
51304-61-1 4-(4-chlorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride
service@apichina.com