| Product Name | 4-(4-chloroanilino)-4-oxobut-2-enoic acid |
| CAS No. | 306935-74-0 |
| Synonyms | 4-[(4-chlorophenyl)amino]-4-oxobut-2-enoic acid; (2E)-4-[(4-chlorophenyl)amino]-4-oxobut-2-enoic acid |
| InChI | InChI=1/C10H8ClNO3/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(14)15/h1-6H,(H,12,13)(H,14,15)/b6-5+ |
| Molecular Formula | C10H8ClNO3 |
| Molecular Weight | 225.6284 |
| Density | 1.448g/cm3 |
| Melting point | 200℃ |
| Boiling point | 466.2°C at 760 mmHg |
| Flash point | 235.7°C |
| Refractive index | 1.642 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306935-74-0 4-(4-chloroanilino)-4-oxobut-2-enoic acid
service@apichina.com