| Product Name | 4-(4-bromophenyl)-1,2,3-thiadiazole |
| CAS No. | 40753-13-7 |
| Synonyms | 1,2,3-Thiadiazole, 4-(4-bromophenyl)-; 4-(4-Bromophenyl)-1,2,3-thiadiazole |
| InChI | InChI=1/C8H5BrN2S/c9-7-3-1-6(2-4-7)8-5-12-11-10-8/h1-5H |
| Molecular Formula | C8H5BrN2S |
| Molecular Weight | 241.1077 |
| Density | 1.642g/cm3 |
| Boiling point | 341.5°C at 760 mmHg |
| Flash point | 160.3°C |
| Refractive index | 1.643 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
40753-13-7 4-(4-bromophenyl)-1,2,3-thiadiazole
service@apichina.com