| Product Name | 4- 3-(Trifluoromethyl)phenyl]-4-piperidinol |
| CAS No. | 2249-28-7 |
| Synonyms | 4-(alpha,alpha,alpha-Trifluoro-m-tolyl)-4-piperidinol; 4-Hydroxy-4(3-Trifluoromethylphenyl)Piperidine |
| InChI | InChI=1/C11H14FNO.CHF2/c12-10-3-1-2-9(8-10)11(14)4-6-13-7-5-11;1-3-2/h1-3,8,13-14H,4-7H2;1H |
| Molecular Formula | C12H15F3NO |
| Molecular Weight | 246.2488096 |
| Melting point | 91-95℃ |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
2249-28-7 4- 3-(trifluoromethyl)phenyl]-4-piperidinol
service@apichina.com