| Product Name | 4-(3-thienyl)benzoic acid |
| CAS No. | 29886-64-4 |
| Synonyms | 4-(thiophen-3-yl)benzoic acid |
| InChI | InChI=1/C11H8O2S/c12-11(13)9-3-1-8(2-4-9)10-5-6-14-7-10/h1-7H,(H,12,13) |
| Molecular Formula | C11H8O2S |
| Molecular Weight | 204.245 |
| Density | 1.303g/cm3 |
| Melting point | 298℃ |
| Boiling point | 344.6°C at 760 mmHg |
| Flash point | 162.2°C |
| Refractive index | 1.635 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
29886-64-4 4-(3-thienyl)benzoic acid
service@apichina.com