| Product Name | 4-(3-hydroxyanilino)-1,2-dihydronaphthalene-1,2-dione |
| CAS No. | 75140-04-4 |
| Synonyms | 4-[(3-hydroxyphenyl)amino]naphthalene-1,2-dione |
| InChI | InChI=1/C16H11NO3/c18-11-5-3-4-10(8-11)17-14-9-15(19)16(20)13-7-2-1-6-12(13)14/h1-9,17-18H |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.2634 |
| Density | 1.442g/cm3 |
| Melting point | 300℃ |
| Boiling point | 488°C at 760 mmHg |
| Flash point | 248.9°C |
| Refractive index | 1.737 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
75140-04-4 4-(3-hydroxyanilino)-1,2-dihydronaphthalene-1,2-dione
service@apichina.com