| Product Name | 4-(3-bromophenyl)-2-methyl-1,3-thiazole |
| CAS No. | 342405-21-4 |
| InChI | InChI=1/C10H8BrNS/c1-7-12-10(6-13-7)8-3-2-4-9(11)5-8/h2-6H,1H3 |
| Molecular Formula | C10H8BrNS |
| Molecular Weight | 254.1462 |
| Density | 1.496g/cm3 |
| Melting point | 63℃ |
| Boiling point | 334.6°C at 760 mmHg |
| Flash point | 156.2°C |
| Refractive index | 1.622 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
342405-21-4 4-(3-bromophenyl)-2-methyl-1,3-thiazole
service@apichina.com