| Product Name | 4-(3,5-dimethyl-1H-pyrazol-1-yl)aniline |
| CAS No. | 52708-32-4 |
| InChI | InChI=1/C11H13N3/c1-8-7-9(2)14(13-8)11-5-3-10(12)4-6-11/h3-7H,12H2,1-2H3 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.241 |
| Density | 1.14g/cm3 |
| Melting point | 78℃ |
| Boiling point | 338.2°C at 760 mmHg |
| Flash point | 158.3°C |
| Refractive index | 1.611 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
52708-32-4 4-(3,5-dimethyl-1h-pyrazol-1-yl)aniline
service@apichina.com